C33H26Cl2F7NO3 — CID 145184359
4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-2,5-dichlorobenzoic acid (PubChem CID 145184359) has the molecular formula C33H26Cl2F7NO3 and a molecular weight of 688.47 g/mol. Its IUPAC name is 4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-2,5-dichlorobenzoic acid.
| Compound Name | 4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-2,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 145184359 |
| Molecular Formula | C33H26Cl2F7NO3 |
| Molecular Weight | 688.47 g/mol |
| Exact Mass | 687.12 |
| IUPAC Name | 4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-2,5-dichlorobenzoic acid |
| SMILES | C=C(C)c1ccc(CC2CN(C(=O)c3cc(Cl)c(C(=O)O)cc3Cl)[C@@H]3CCc4cc(C(F)(C(F)(F)F)C(F)(F)F)ccc4[C@H]23)cc1 |
| InChI | InChI=1S/C33H26Cl2F7NO3/c1-16(2)18-5-3-17(4-6-18)11-20-15-43(29(44)23-13-26(35)24(30(45)46)14-25(23)34)27-10-7-19-12-21(8-9-22(19)28(20)27)31(36,32(37,38)39)33(40,41)42/h3-6,8-9,12-14,20,27-28H,1,7,10-11,15H2,2H3,(H,45,46)/t20?,27-,28+/m1/s1 |
| InChIKey | WJYXMECNTPVZIT-UNYBACTRSA-N |
| XLogP | 9.43 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.47 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |