C32H34F7NO2 — CID 145183767
1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-2-(oxan-4-yl)ethanone (PubChem CID 145183767) has the molecular formula C32H34F7NO2 and a molecular weight of 597.62 g/mol. Its IUPAC name is 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 145183767 |
| Molecular Formula | C32H34F7NO2 |
| Molecular Weight | 597.62 g/mol |
| Exact Mass | 597.25 |
| IUPAC Name | 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-2-(oxan-4-yl)ethanone |
| SMILES | C=C(C)c1ccc(CC2CN(C(=O)CC3CCOCC3)[C@@H]3CCc4cc(C(F)(C(F)(F)F)C(F)(F)F)ccc4[C@H]23)cc1 |
| InChI | InChI=1S/C32H34F7NO2/c1-19(2)22-5-3-20(4-6-22)15-24-18-40(28(41)16-21-11-13-42-14-12-21)27-10-7-23-17-25(8-9-26(23)29(24)27)30(33,31(34,35)36)32(37,38)39/h3-6,8-9,17,21,24,27,29H,1,7,10-16,18H2,2H3/t24?,27-,29+/m1/s1 |
| InChIKey | JPIAEHWXDMNCCA-NSYPLHIYSA-N |
| XLogP | 7.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.62 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |