C30H30F7NO — CID 145184088
[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-cyclobutylmethanone (PubChem CID 145184088) has the molecular formula C30H30F7NO and a molecular weight of 553.56 g/mol. Its IUPAC name is [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 145184088 |
| Molecular Formula | C30H30F7NO |
| Molecular Weight | 553.56 g/mol |
| Exact Mass | 553.22 |
| IUPAC Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1-[(4-prop-1-en-2-ylphenyl)methyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-cyclobutylmethanone |
| SMILES | C=C(C)c1ccc(CC2CN(C(=O)C3CCC3)[C@@H]3CCc4cc(C(F)(C(F)(F)F)C(F)(F)F)ccc4[C@H]23)cc1 |
| InChI | InChI=1S/C30H30F7NO/c1-17(2)19-8-6-18(7-9-19)14-22-16-38(27(39)20-4-3-5-20)25-13-10-21-15-23(11-12-24(21)26(22)25)28(31,29(32,33)34)30(35,36)37/h6-9,11-12,15,20,22,25-26H,1,3-5,10,13-14,16H2,2H3/t22?,25-,26+/m1/s1 |
| InChIKey | CKZGNRMNCLCARI-DVSPJEKPSA-N |
| XLogP | 7.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.56 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |