C25H25N3 — CID 145198629
acetylene;2-ethyl-4-phenyl-6-[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-1,3,5-triazine (PubChem CID 145198629) has the molecular formula C25H25N3 and a molecular weight of 367.50 g/mol. Its IUPAC name is acetylene;2-ethyl-4-phenyl-6-[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-1,3,5-triazine.
| Compound Name | acetylene;2-ethyl-4-phenyl-6-[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 145198629 |
| Molecular Formula | C25H25N3 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | acetylene;2-ethyl-4-phenyl-6-[(2E,4E)-5-phenylhexa-2,4-dien-3-yl]-1,3,5-triazine |
| SMILES | C#C.C/C=C(\C=C(/C)c1ccccc1)c1nc(CC)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C23H23N3.C2H2/c1-4-18(16-17(3)19-12-8-6-9-13-19)22-24-21(5-2)25-23(26-22)20-14-10-7-11-15-20;1-2/h4,6-16H,5H2,1-3H3;1-2H/b17-16+,18-4+; |
| InChIKey | TVKLFBCZXKLRAS-QMMDYMEESA-N |
| XLogP | 5.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|