C38H44Cl2N6O3 — CID 145363402
[6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl]-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]methanone;formic acid (PubChem CID 145363402) has the molecular formula C38H44Cl2N6O3 and a molecular weight of 703.72 g/mol. Its IUPAC name is [6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl]-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]methanone;formic acid.
| Compound Name | [6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl]-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 145363402 |
| Molecular Formula | C38H44Cl2N6O3 |
| Molecular Weight | 703.72 g/mol |
| Exact Mass | 702.29 |
| IUPAC Name | [6-chloro-3-[4-(4-chloro-3,5-dimethylphenyl)butyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indol-2-yl]-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]methanone;formic acid |
| SMILES | Cc1ccnc(N2CCN(C(=O)c3[nH]c4c(-c5c(C)nn(C)c5C)c(Cl)ccc4c3CCCCc3cc(C)c(Cl)c(C)c3)CC2)c1.O=CO |
| InChI | InChI=1S/C37H42Cl2N6O.CH2O2/c1-22-13-14-40-31(19-22)44-15-17-45(18-16-44)37(46)36-28(10-8-7-9-27-20-23(2)34(39)24(3)21-27)29-11-12-30(38)33(35(29)41-36)32-25(4)42-43(6)26(32)5;2-1-3/h11-14,19-21,41H,7-10,15-18H2,1-6H3;1H,(H,2,3) |
| InChIKey | YKFXAJUVNOMJEH-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|