C14H26FN — CID 145379015
(3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;2-methylhexane (PubChem CID 145379015) has the molecular formula C14H26FN and a molecular weight of 227.37 g/mol. Its IUPAC name is (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;2-methylhexane.
| Compound Name | (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;2-methylhexane |
|---|---|
| PubChem CID | 145379015 |
| Molecular Formula | C14H26FN |
| Molecular Weight | 227.37 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | (3E)-3-fluoro-5-methylhexa-1,3,5-trien-2-amine;2-methylhexane |
| SMILES | C=C(C)/C=C(/F)C(=C)N.CCCCC(C)C |
| InChI | InChI=1S/C7H10FN.C7H16/c1-5(2)4-7(8)6(3)9;1-4-5-6-7(2)3/h4H,1,3,9H2,2H3;7H,4-6H2,1-3H3/b7-4+; |
| InChIKey | ZRQWVQHDBQXQAG-KQGICBIGSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|