C18HF19O — CID 146021213
(4E)-2,3,6-trifluoro-4-[2,2,3,3,3-pentafluoro-1-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propylidene]cyclohexa-2,5-dien-1-one (PubChem CID 146021213) has the molecular formula C18HF19O and a molecular weight of 594.17 g/mol. Its IUPAC name is (4E)-2,3,6-trifluoro-4-[2,2,3,3,3-pentafluoro-1-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propylidene]cyclohexa-2,5-dien-1-one.
| Compound Name | (4E)-2,3,6-trifluoro-4-[2,2,3,3,3-pentafluoro-1-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 146021213 |
| Molecular Formula | C18HF19O |
| Molecular Weight | 594.17 g/mol |
| Exact Mass | 593.97 |
| IUPAC Name | (4E)-2,3,6-trifluoro-4-[2,2,3,3,3-pentafluoro-1-[2,3,4,5-tetrafluoro-6-(1,1,2,2,3,3,3-heptafluoropropyl)phenyl]propylidene]cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C(F)=C/C(=C(/c2c(F)c(F)c(F)c(F)c2C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F)C(F)=C1F |
| InChI | InChI=1S/C18HF19O/c19-3-1-2(7(20)12(25)13(3)38)5(15(28,29)17(32,33)34)4-6(9(22)11(24)10(23)8(4)21)14(26,27)16(30,31)18(35,36)37/h1H/b5-2+ |
| InChIKey | YHPBGTGJJRSKHY-GORDUTHDSA-N |
| XLogP | 8.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.17 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|