C17H25ClN6O — CID 146140302
2-chloro-N-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-7H-purin-6-amine (PubChem CID 146140302) has the molecular formula C17H25ClN6O and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-chloro-N-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 146140302 |
| Molecular Formula | C17H25ClN6O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-chloro-N-[[1-(4-methoxypiperidin-1-yl)cyclopentyl]methyl]-7H-purin-6-amine |
| SMILES | COC1CCN(C2(CNc3nc(Cl)nc4nc[nH]c34)CCCC2)CC1 |
| InChI | InChI=1S/C17H25ClN6O/c1-25-12-4-8-24(9-5-12)17(6-2-3-7-17)10-19-14-13-15(21-11-20-13)23-16(18)22-14/h11-12H,2-10H2,1H3,(H2,19,20,21,22,23) |
| InChIKey | GSFUOTRDCHUYRD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |