C18H18F2IN2O- — CID 147276574
CID 147276574 (PubChem CID 147276574) has the molecular formula C18H18F2IN2O- and a molecular weight of 443.26 g/mol.
| Compound Name | CID 147276574 |
|---|---|
| PubChem CID | 147276574 |
| Molecular Formula | C18H18F2IN2O- |
| Molecular Weight | 443.26 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | — |
| SMILES | CC1(C)[C@H]2C[I-]C[C@]1(C)c1nnc(Oc3c(F)cccc3F)cc12 |
| InChI | InChI=1S/C18H18F2IN2O/c1-17(2)11-8-21-9-18(17,3)16-10(11)7-14(22-23-16)24-15-12(19)5-4-6-13(15)20/h4-7,11H,8-9H2,1-3H3/q-1/t11-,18+/m0/s1 |
| InChIKey | HWCSQYUNTMTSRQ-BBATYDOGSA-N |
| XLogP | 1.03 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|