C26H19NO9 — CID 149083110
20-amino-6,8,13,16-tetrahydroxy-7-methyl-4,11,18-trioxo-19-oxahexacyclo[12.11.0.03,12.05,10.015,23.017,21]pentacosa-1,3(12),5,7,9,13,15(23),21-octaene-2-carbaldehyde (PubChem CID 149083110) has the molecular formula C26H19NO9 and a molecular weight of 489.44 g/mol. Its IUPAC name is 20-amino-6,8,13,16-tetrahydroxy-7-methyl-4,11,18-trioxo-19-oxahexacyclo[12.11.0.03,12.05,10.015,23.017,21]pentacosa-1,3(12),5,7,9,13,15(23),21-octaene-2-carbaldehyde.
| Compound Name | 20-amino-6,8,13,16-tetrahydroxy-7-methyl-4,11,18-trioxo-19-oxahexacyclo[12.11.0.03,12.05,10.015,23.017,21]pentacosa-1,3(12),5,7,9,13,15(23),21-octaene-2-carbaldehyde |
|---|---|
| PubChem CID | 149083110 |
| Molecular Formula | C26H19NO9 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 20-amino-6,8,13,16-tetrahydroxy-7-methyl-4,11,18-trioxo-19-oxahexacyclo[12.11.0.03,12.05,10.015,23.017,21]pentacosa-1,3(12),5,7,9,13,15(23),21-octaene-2-carbaldehyde |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)c1c(C=O)c3c(c(O)c1C2=O)C1=C(C=C2C(N)OC(=O)C2C1O)CC3 |
| InChI | InChI=1S/C26H19NO9/c1-7-13(29)5-10-17(20(7)30)23(33)16-12(6-28)9-3-2-8-4-11-18(26(35)36-25(11)27)22(32)14(8)15(9)24(34)19(16)21(10)31/h4-6,18,22,25,29-30,32,34H,2-3,27H2,1H3 |
| InChIKey | QQSLNLLAUOSDQG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 184.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|