C20H27N8O6P — CID 150305261
[2-[(2R,3R,5R)-2-(aminomethyl)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-3-yl]oxyethyl-methylamino]oxyphosphonamidous acid (PubChem CID 150305261) has the molecular formula C20H27N8O6P and a molecular weight of 506.46 g/mol. Its IUPAC name is [2-[(2R,3R,5R)-2-(aminomethyl)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-3-yl]oxyethyl-methylamino]oxyphosphonamidous acid.
| Compound Name | [2-[(2R,3R,5R)-2-(aminomethyl)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-3-yl]oxyethyl-methylamino]oxyphosphonamidous acid |
|---|---|
| PubChem CID | 150305261 |
| Molecular Formula | C20H27N8O6P |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | [2-[(2R,3R,5R)-2-(aminomethyl)-5-(6-benzamidopurin-9-yl)-3-hydroxyoxolan-3-yl]oxyethyl-methylamino]oxyphosphonamidous acid |
| SMILES | CN(CCO[C@]1(O)C[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)O[C@@H]1CN)OP(N)O |
| InChI | InChI=1S/C20H27N8O6P/c1-27(34-35(22)31)7-8-32-20(30)9-15(33-14(20)10-21)28-12-25-16-17(23-11-24-18(16)28)26-19(29)13-5-3-2-4-6-13/h2-6,11-12,14-15,30-31H,7-10,21-22H2,1H3,(H,23,24,26,29)/t14-,15-,20-,35?/m1/s1 |
| InChIKey | BLMCKGSPWOCLDR-AYKXNXJNSA-N |
| XLogP | 0.07 |
| TPSA | 196.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|