C20H24O8S — CID 15194819
methyl (E)-3-[(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-2-oxo-5-propyloxolan-3-yl]prop-2-enoate (PubChem CID 15194819) has the molecular formula C20H24O8S and a molecular weight of 424.47 g/mol. Its IUPAC name is methyl (E)-3-[(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-2-oxo-5-propyloxolan-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-2-oxo-5-propyloxolan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15194819 |
| Molecular Formula | C20H24O8S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl (E)-3-[(3S,4R,5R)-3-(benzenesulfonyl)-4-(2-methoxy-2-oxoethyl)-2-oxo-5-propyloxolan-3-yl]prop-2-enoate |
| SMILES | CCC[C@H]1OC(=O)[C@@](/C=C/C(=O)OC)(S(=O)(=O)c2ccccc2)[C@@H]1CC(=O)OC |
| InChI | InChI=1S/C20H24O8S/c1-4-8-16-15(13-18(22)27-3)20(19(23)28-16,12-11-17(21)26-2)29(24,25)14-9-6-5-7-10-14/h5-7,9-12,15-16H,4,8,13H2,1-3H3/b12-11+/t15-,16-,20+/m1/s1 |
| InChIKey | UMCLQQJANROJET-TZQZZILYSA-N |
| XLogP | 1.83 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|