C47H50BrNO8 — CID 153435649
6-[4-[[4-[5-bromo-6-[[4-[3-(3,3-dimethyloxiran-2-yl)oxypropoxy]phenyl]methoxy]naphthalen-2-yl]-2-methanimidoylphenoxy]methyl]phenoxy]hexyl prop-2-enoate (PubChem CID 153435649) has the molecular formula C47H50BrNO8 and a molecular weight of 836.82 g/mol. Its IUPAC name is 6-[4-[[4-[5-bromo-6-[[4-[3-(3,3-dimethyloxiran-2-yl)oxypropoxy]phenyl]methoxy]naphthalen-2-yl]-2-methanimidoylphenoxy]methyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | 6-[4-[[4-[5-bromo-6-[[4-[3-(3,3-dimethyloxiran-2-yl)oxypropoxy]phenyl]methoxy]naphthalen-2-yl]-2-methanimidoylphenoxy]methyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 153435649 |
| Molecular Formula | C47H50BrNO8 |
| Molecular Weight | 836.82 g/mol |
| Exact Mass | 835.27 |
| IUPAC Name | 6-[4-[[4-[5-bromo-6-[[4-[3-(3,3-dimethyloxiran-2-yl)oxypropoxy]phenyl]methoxy]naphthalen-2-yl]-2-methanimidoylphenoxy]methyl]phenoxy]hexyl prop-2-enoate |
| SMILES | [H]/N=C/c1cc(-c2ccc3c(Br)c(OCc4ccc(OCCCOC5OC5(C)C)cc4)ccc3c2)ccc1OCc1ccc(OCCCCCCOC(=O)C=C)cc1 |
| InChI | InChI=1S/C47H50BrNO8/c1-4-44(50)53-25-8-6-5-7-24-51-39-17-10-33(11-18-39)31-55-42-22-15-36(29-38(42)30-49)35-14-21-41-37(28-35)16-23-43(45(41)48)56-32-34-12-19-40(20-13-34)52-26-9-27-54-46-47(2,3)57-46/h4,10-23,28-30,46,49H,1,5-9,24-27,31-32H2,2-3H3/b49-30+ |
| InChIKey | LPDUWKZHEICUCO-OUFTWPDZSA-N |
| XLogP | 11.01 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.82 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|