C14H22N2O — CID 154808840
(1R,8R)-1'-methylspiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,4'-piperidine] (PubChem CID 154808840) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,8R)-1'-methylspiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,4'-piperidine].
| Compound Name | (1R,8R)-1'-methylspiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,4'-piperidine] |
|---|---|
| PubChem CID | 154808840 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (1R,8R)-1'-methylspiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,4'-piperidine] |
| SMILES | CN1CCC2(CC1)CC1C[C@@H]3C=C[C@]1(CN2)O3 |
| InChI | InChI=1S/C14H22N2O/c1-16-6-4-13(5-7-16)9-11-8-12-2-3-14(11,17-12)10-15-13/h2-3,11-12,15H,4-10H2,1H3/t11?,12-,14+/m0/s1 |
| InChIKey | IOXUZCGQDWCBPF-VBVNFKHJSA-N |
| XLogP | 1.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|