C46H57N2O+ — CID 155055172
[4-[3-[4-(N-butyl-2,4,6-trimethylanilino)-2-hydroxyphenyl]-2-ethyl-4-methylidenecyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-pentyl-(2,4,6-trimethylphenyl)azanium (PubChem CID 155055172) has the molecular formula C46H57N2O+ and a molecular weight of 653.98 g/mol. Its IUPAC name is [4-[3-[4-(N-butyl-2,4,6-trimethylanilino)-2-hydroxyphenyl]-2-ethyl-4-methylidenecyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-pentyl-(2,4,6-trimethylphenyl)azanium.
| Compound Name | [4-[3-[4-(N-butyl-2,4,6-trimethylanilino)-2-hydroxyphenyl]-2-ethyl-4-methylidenecyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-pentyl-(2,4,6-trimethylphenyl)azanium |
|---|---|
| PubChem CID | 155055172 |
| Molecular Formula | C46H57N2O+ |
| Molecular Weight | 653.98 g/mol |
| Exact Mass | 653.45 |
| IUPAC Name | [4-[3-[4-(N-butyl-2,4,6-trimethylanilino)-2-hydroxyphenyl]-2-ethyl-4-methylidenecyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-pentyl-(2,4,6-trimethylphenyl)azanium |
| SMILES | C=C1C(=C2C=CC(=[N+](CCCCC)c3c(C)cc(C)cc3C)C=C2)C(CC)=C1c1ccc(N(CCCC)c2c(C)cc(C)cc2C)cc1O |
| InChI | InChI=1S/C46H56N2O/c1-11-14-16-24-47(45-32(6)25-30(4)26-33(45)7)38-19-17-37(18-20-38)43-36(10)44(40(43)13-3)41-22-21-39(29-42(41)49)48(23-15-12-2)46-34(8)27-31(5)28-35(46)9/h17-22,25-29H,10-16,23-24H2,1-9H3/p+1 |
| InChIKey | JRJGKKUACQLUFF-UHFFFAOYSA-O |
| XLogP | 12.31 |
| TPSA | 26.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.98 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|