C17H25N3O2 — CID 155072763
(3R,4aS,7aS)-3-(phenylmethoxyamino)-6-prop-2-enyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-7-ol (PubChem CID 155072763) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is (3R,4aS,7aS)-3-(phenylmethoxyamino)-6-prop-2-enyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-7-ol.
| Compound Name | (3R,4aS,7aS)-3-(phenylmethoxyamino)-6-prop-2-enyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-7-ol |
|---|---|
| PubChem CID | 155072763 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | (3R,4aS,7aS)-3-(phenylmethoxyamino)-6-prop-2-enyl-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-7-ol |
| SMILES | C=CCN1C[C@@H]2C[C@@H](NOCc3ccccc3)CN[C@@H]2C1O |
| InChI | InChI=1S/C17H25N3O2/c1-2-8-20-11-14-9-15(10-18-16(14)17(20)21)19-22-12-13-6-4-3-5-7-13/h2-7,14-19,21H,1,8-12H2/t14-,15+,16-,17?/m0/s1 |
| InChIKey | SQRFPGWDTKEICK-TVXGVJEUSA-N |
| XLogP | 0.87 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|