C36H48O5P2 — CID 155575722
methoxy-[3-[methoxy(phenyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)phenoxy]-phenylphosphane (PubChem CID 155575722) has the molecular formula C36H48O5P2 and a molecular weight of 622.72 g/mol. Its IUPAC name is methoxy-[3-[methoxy(phenyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)phenoxy]-phenylphosphane.
| Compound Name | methoxy-[3-[methoxy(phenyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)phenoxy]-phenylphosphane |
|---|---|
| PubChem CID | 155575722 |
| Molecular Formula | C36H48O5P2 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | methoxy-[3-[methoxy(phenyl)phosphoryl]oxy-2-(3-methylcyclohex-2-en-1-yl)-5-(2-methyloctan-2-yl)phenoxy]-phenylphosphane |
| SMILES | CCCCCCC(C)(C)c1cc(OP(OC)c2ccccc2)c(C2C=C(C)CCC2)c(OP(=O)(OC)c2ccccc2)c1 |
| InChI | InChI=1S/C36H48O5P2/c1-7-8-9-16-24-36(3,4)30-26-33(40-42(38-5)31-20-12-10-13-21-31)35(29-19-17-18-28(2)25-29)34(27-30)41-43(37,39-6)32-22-14-11-15-23-32/h10-15,20-23,25-27,29H,7-9,16-19,24H2,1-6H3 |
| InChIKey | GJTMOKYRDDTEDX-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|