C22H31F3S — CID 155576093
2-methyl-1-(3-methylcyclohex-2-en-1-yl)-4-pentyl-3-(3,3,3-trifluoropropylsulfanyl)benzene (PubChem CID 155576093) has the molecular formula C22H31F3S and a molecular weight of 384.55 g/mol. Its IUPAC name is 2-methyl-1-(3-methylcyclohex-2-en-1-yl)-4-pentyl-3-(3,3,3-trifluoropropylsulfanyl)benzene.
| Compound Name | 2-methyl-1-(3-methylcyclohex-2-en-1-yl)-4-pentyl-3-(3,3,3-trifluoropropylsulfanyl)benzene |
|---|---|
| PubChem CID | 155576093 |
| Molecular Formula | C22H31F3S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2-methyl-1-(3-methylcyclohex-2-en-1-yl)-4-pentyl-3-(3,3,3-trifluoropropylsulfanyl)benzene |
| SMILES | CCCCCc1ccc(C2C=C(C)CCC2)c(C)c1SCCC(F)(F)F |
| InChI | InChI=1S/C22H31F3S/c1-4-5-6-9-18-11-12-20(19-10-7-8-16(2)15-19)17(3)21(18)26-14-13-22(23,24)25/h11-12,15,19H,4-10,13-14H2,1-3H3 |
| InChIKey | XIZJGKQUMNGWLM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|