C32H37F4O6S2+ — CID 155623552
phenyl-[4-(3,3,4,4-tetrafluoro-4-sulfobutoxy)phenyl]-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 155623552) has the molecular formula C32H37F4O6S2+ and a molecular weight of 657.77 g/mol. Its IUPAC name is phenyl-[4-(3,3,4,4-tetrafluoro-4-sulfobutoxy)phenyl]-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | phenyl-[4-(3,3,4,4-tetrafluoro-4-sulfobutoxy)phenyl]-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155623552 |
| Molecular Formula | C32H37F4O6S2+ |
| Molecular Weight | 657.77 g/mol |
| Exact Mass | 657.20 |
| IUPAC Name | phenyl-[4-(3,3,4,4-tetrafluoro-4-sulfobutoxy)phenyl]-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | CC(C)C1OC(C)(c2ccc([S+](c3ccccc3)c3ccc(OCCC(F)(F)C(F)(F)S(=O)(=O)O)cc3)cc2)OCC1(C)C |
| InChI | InChI=1S/C32H36F4O6S2/c1-22(2)28-29(3,4)21-41-30(5,42-28)23-11-15-26(16-12-23)43(25-9-7-6-8-10-25)27-17-13-24(14-18-27)40-20-19-31(33,34)32(35,36)44(37,38)39/h6-18,22,28H,19-21H2,1-5H3/p+1 |
| InChIKey | NMBGVYGNVVMSPK-UHFFFAOYSA-O |
| XLogP | 7.94 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.77 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|