C20H27N — CID 157439850
9H-carbazole;2,2,4-trimethylpentane (PubChem CID 157439850) has the molecular formula C20H27N and a molecular weight of 281.44 g/mol. Its IUPAC name is 9H-carbazole;2,2,4-trimethylpentane.
| Compound Name | 9H-carbazole;2,2,4-trimethylpentane |
|---|---|
| PubChem CID | 157439850 |
| Molecular Formula | C20H27N |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 9H-carbazole;2,2,4-trimethylpentane |
| SMILES | CC(C)CC(C)(C)C.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C8H18/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-7(2)6-8(3,4)5/h1-8,13H;7H,6H2,1-5H3 |
| InChIKey | BRNPJTXCGMWJBG-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |