C45H39N9O3 — CID 157493367
2,4,6-triphenoxy-1,3,5-triazine;2-N,4-N,6-N-tris(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 157493367) has the molecular formula C45H39N9O3 and a molecular weight of 753.87 g/mol. Its IUPAC name is 2,4,6-triphenoxy-1,3,5-triazine;2-N,4-N,6-N-tris(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2,4,6-triphenoxy-1,3,5-triazine;2-N,4-N,6-N-tris(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 157493367 |
| Molecular Formula | C45H39N9O3 |
| Molecular Weight | 753.87 g/mol |
| Exact Mass | 753.32 |
| IUPAC Name | 2,4,6-triphenoxy-1,3,5-triazine;2-N,4-N,6-N-tris(4-methylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(Nc2nc(Nc3ccc(C)cc3)nc(Nc3ccc(C)cc3)n2)cc1.c1ccc(Oc2nc(Oc3ccccc3)nc(Oc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H24N6.C21H15N3O3/c1-16-4-10-19(11-5-16)25-22-28-23(26-20-12-6-17(2)7-13-20)30-24(29-22)27-21-14-8-18(3)9-15-21;1-4-10-16(11-5-1)25-19-22-20(26-17-12-6-2-7-13-17)24-21(23-19)27-18-14-8-3-9-15-18/h4-15H,1-3H3,(H3,25,26,27,28,29,30);1-15H |
| InChIKey | BXNPFKHHOOAGEH-UHFFFAOYSA-N |
| XLogP | 11.28 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.87 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |