C25H33N3O9P+ — CID 158012959
[3-hydroxy-1-(1H-imidazol-3-ium-5-yl)but-3-en-2-yl]azanium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] hydrogen phosphate (PubChem CID 158012959) has the molecular formula C25H33N3O9P+ and a molecular weight of 550.53 g/mol. Its IUPAC name is [3-hydroxy-1-(1H-imidazol-3-ium-5-yl)but-3-en-2-yl]azanium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] hydrogen phosphate.
| Compound Name | [3-hydroxy-1-(1H-imidazol-3-ium-5-yl)but-3-en-2-yl]azanium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 158012959 |
| Molecular Formula | C25H33N3O9P+ |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | [3-hydroxy-1-(1H-imidazol-3-ium-5-yl)but-3-en-2-yl]azanium;[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] hydrogen phosphate |
| SMILES | C=C(O)C([NH3+])Cc1c[nH+]c[nH]1.COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)([O-])O |
| InChI | InChI=1S/C18H21O8P.C7H11N3O/c1-22-14-8-7-12(9-15(14)26-27(19,20)21)5-6-13-10-16(23-2)18(25-4)17(11-13)24-3;1-5(11)7(8)2-6-3-9-4-10-6/h5-11H,1-4H3,(H2,19,20,21);3-4,7,11H,1-2,8H2,(H,9,10)/p+1/b6-5-; |
| InChIKey | FFCRYIFRKSHILD-YSMBQZINSA-O |
| XLogP | 1.78 |
| TPSA | 184.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|