C35H50N4O6S — CID 158020922
N-[2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butanamide (PubChem CID 158020922) has the molecular formula C35H50N4O6S and a molecular weight of 654.87 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butanamide.
| Compound Name | N-[2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butanamide |
|---|---|
| PubChem CID | 158020922 |
| Molecular Formula | C35H50N4O6S |
| Molecular Weight | 654.87 g/mol |
| Exact Mass | 654.35 |
| IUPAC Name | N-[2-[2-[2-[2-(1-adamantyloxy)ethoxy]ethoxy]ethoxy]ethyl]-4-[3-(4-isocyano-3-methylphenyl)-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]butanamide |
| SMILES | [C-]#[N+]c1ccc(N2C(=O)C(C)(C)N(CCCC(=O)NCCOCCOCCOCCOC34CC5CC(CC(C5)C3)C4)C2=S)cc1C |
| InChI | InChI=1S/C35H50N4O6S/c1-25-18-29(7-8-30(25)36-4)39-32(41)34(2,3)38(33(39)46)10-5-6-31(40)37-9-11-42-12-13-43-14-15-44-16-17-45-35-22-26-19-27(23-35)21-28(20-26)24-35/h7-8,18,26-28H,5-6,9-17,19-24H2,1-3H3,(H,37,40) |
| InChIKey | ZJLMWUJIOHHSDW-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|