C26H39N5O7 — CID 158222440
N-[(3S,6R)-9-(carbamoylamino)-6-[(2-deuterio-2-oxoethyl)carbamoyl]-2-methyl-4-oxononan-3-yl]-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide (PubChem CID 158222440) has the molecular formula C26H39N5O7 and a molecular weight of 534.63 g/mol. Its IUPAC name is N-[(3S,6R)-9-(carbamoylamino)-6-[(2-deuterio-2-oxoethyl)carbamoyl]-2-methyl-4-oxononan-3-yl]-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide.
| Compound Name | N-[(3S,6R)-9-(carbamoylamino)-6-[(2-deuterio-2-oxoethyl)carbamoyl]-2-methyl-4-oxononan-3-yl]-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 158222440 |
| Molecular Formula | C26H39N5O7 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | N-[(3S,6R)-9-(carbamoylamino)-6-[(2-deuterio-2-oxoethyl)carbamoyl]-2-methyl-4-oxononan-3-yl]-4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexane-1-carboxamide |
| SMILES | [2H]C(=O)CNC(=O)[C@H](CCCNC(N)=O)CC(=O)[C@@H](NC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1)C(C)C |
| InChI | InChI=1S/C26H39N5O7/c1-16(2)23(20(33)14-19(24(36)28-12-13-32)4-3-11-29-26(27)38)30-25(37)18-7-5-17(6-8-18)15-31-21(34)9-10-22(31)35/h9-10,13,16-19,23H,3-8,11-12,14-15H2,1-2H3,(H,28,36)(H,30,37)(H3,27,29,38)/t17?,18?,19-,23+/m1/s1/i13D |
| InChIKey | GDKBNLXGXRXNTK-PKUUVNSUSA-N |
| XLogP | 0.20 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|