C39H48O5S — CID 15838169
5-[(2R,3R,11S,14S)-15-hydroxy-14-methyl-7-phenylmethoxy-3-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl]pentyl 4-methylbenzenesulfonate (PubChem CID 15838169) has the molecular formula C39H48O5S and a molecular weight of 628.88 g/mol. Its IUPAC name is 5-[(2R,3R,11S,14S)-15-hydroxy-14-methyl-7-phenylmethoxy-3-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl]pentyl 4-methylbenzenesulfonate.
| Compound Name | 5-[(2R,3R,11S,14S)-15-hydroxy-14-methyl-7-phenylmethoxy-3-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl]pentyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15838169 |
| Molecular Formula | C39H48O5S |
| Molecular Weight | 628.88 g/mol |
| Exact Mass | 628.32 |
| IUPAC Name | 5-[(2R,3R,11S,14S)-15-hydroxy-14-methyl-7-phenylmethoxy-3-pentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5(10),6,8-trienyl]pentyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCC[C@@H]2Cc3cc(OCc4ccccc4)ccc3[C@H]3CC[C@]4(C)C5(O)CCC4(CC5)[C@H]23)cc1 |
| InChI | InChI=1S/C39H48O5S/c1-28-12-15-33(16-13-28)45(41,42)44-24-8-4-7-11-30-25-31-26-32(43-27-29-9-5-3-6-10-29)14-17-34(31)35-18-19-37(2)38(36(30)35)20-22-39(37,40)23-21-38/h3,5-6,9-10,12-17,26,30,35-36,40H,4,7-8,11,18-25,27H2,1-2H3/t30-,35-,36-,37+,38?,39?/m1/s1 |
| InChIKey | XTTLVHFCBPIXES-OWGIFPEVSA-N |
| XLogP | 8.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.88 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|