About 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane
4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane (PubChem CID 158615103) has the molecular formula C18H28S2
and a molecular weight of 308.56 g/mol. Its IUPAC name is 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane.
Analyze 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane?
The IUPAC name of 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane (CID 158615103) is 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane.
What is the SMILES notation for 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane?
The canonical SMILES for 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane is C1CC2CC3CC(S1)C2C3.C1CC2CC3CC2CC3S1.
What is the InChIKey of 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane?
The InChIKey is HXHHUJXOQDTORE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H14S/c1-2-10-9-5-6-3-7(1)8(9)4-6;1-2-10-9-5-7-4-8(9)3-6(1)7/h2*6-9H,1-5H2.
What are the key properties of 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane?
4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane has a molecular weight of 308.56 g/mol, XLogP of 5.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-thiatricyclo[5.2.1.03,8]decane;4-thiatricyclo[5.3.0.03,9]decane is sourced from PubChem (CID 158615103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).