About dimethylazanium;propane-1,2-diol;chloride
dimethylazanium;propane-1,2-diol;chloride (PubChem CID 158629461) has the molecular formula C5H16ClNO2
and a molecular weight of 157.64 g/mol. Its IUPAC name is dimethylazanium;propane-1,2-diol;chloride.
Molecular Properties
| Compound Name | dimethylazanium;propane-1,2-diol;chloride |
| PubChem CID | 158629461 |
| Molecular Formula | C5H16ClNO2 |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | dimethylazanium;propane-1,2-diol;chloride |
| SMILES | CC(O)CO.C[NH2+]C.[Cl-] |
| InChI | InChI=1S/C3H8O2.C2H7N.ClH/c1-3(5)2-4;1-3-2;/h3-5H,2H2,1H3;3H,1-2H3;1H |
| InChIKey | YOLJKNRKXGXCAI-UHFFFAOYSA-N |
| XLogP | -4.83 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | -4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dimethylazanium;propane-1,2-diol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylazanium;propane-1,2-diol;chloride?
The IUPAC name of dimethylazanium;propane-1,2-diol;chloride (CID 158629461) is dimethylazanium;propane-1,2-diol;chloride.
What is the SMILES notation for dimethylazanium;propane-1,2-diol;chloride?
The canonical SMILES for dimethylazanium;propane-1,2-diol;chloride is CC(O)CO.C[NH2+]C.[Cl-].
What is the InChIKey of dimethylazanium;propane-1,2-diol;chloride?
The InChIKey is YOLJKNRKXGXCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H7N.ClH/c1-3(5)2-4;1-3-2;/h3-5H,2H2,1H3;3H,1-2H3;1H.
What are the key properties of dimethylazanium;propane-1,2-diol;chloride?
dimethylazanium;propane-1,2-diol;chloride has a molecular weight of 157.64 g/mol, XLogP of -4.83, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylazanium;propane-1,2-diol;chloride is sourced from PubChem (CID 158629461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).