C13H10N6O2 — CID 158880435
3,7-dihydropurine-2,6-dione;quinazoline (PubChem CID 158880435) has the molecular formula C13H10N6O2 and a molecular weight of 282.26 g/mol. Its IUPAC name is 3,7-dihydropurine-2,6-dione;quinazoline.
| Compound Name | 3,7-dihydropurine-2,6-dione;quinazoline |
|---|---|
| PubChem CID | 158880435 |
| Molecular Formula | C13H10N6O2 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3,7-dihydropurine-2,6-dione;quinazoline |
| SMILES | O=c1[nH]c(=O)c2[nH]cnc2[nH]1.c1ccc2ncncc2c1 |
| InChI | InChI=1S/C8H6N2.C5H4N4O2/c1-2-4-8-7(3-1)5-9-6-10-8;10-4-2-3(7-1-6-2)8-5(11)9-4/h1-6H;1H,(H3,6,7,8,9,10,11) |
| InChIKey | JCYQJTGXDZLLHO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |