About 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone
1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone (PubChem CID 160805678) has the molecular formula C13H10Br2N2OS
and a molecular weight of 402.11 g/mol. Its IUPAC name is 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone.
Molecular Properties
| Compound Name | 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone |
| PubChem CID | 160805678 |
| Molecular Formula | C13H10Br2N2OS |
| Molecular Weight | 402.11 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone |
| SMILES | O=C(CBr)c1ccc(Br)s1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C6H4Br2OS/c1-2-4-7-6(3-1)8-5-9-7;7-3-4(9)5-1-2-6(8)10-5/h1-5H,(H,8,9);1-2H,3H2 |
| InChIKey | SDQPRLGJBLYWPS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.11 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone?
The IUPAC name of 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone (CID 160805678) is 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone.
What is the SMILES notation for 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone?
The canonical SMILES for 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone is O=C(CBr)c1ccc(Br)s1.c1ccc2[nH]cnc2c1.
What is the InChIKey of 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone?
The InChIKey is SDQPRLGJBLYWPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C6H4Br2OS/c1-2-4-7-6(3-1)8-5-9-7;7-3-4(9)5-1-2-6(8)10-5/h1-5H,(H,8,9);1-2H,3H2.
What are the key properties of 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone?
1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone has a molecular weight of 402.11 g/mol, XLogP of 4.65, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole;2-bromo-1-(5-bromothiophen-2-yl)ethanone is sourced from PubChem (CID 160805678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).