About 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide
1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide (PubChem CID 160852732) has the molecular formula C18H18IN3
and a molecular weight of 403.27 g/mol. Its IUPAC name is 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide.
Molecular Properties
| Compound Name | 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide |
| PubChem CID | 160852732 |
| Molecular Formula | C18H18IN3 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide |
| SMILES | CN1CC=Cc2cccnc21.I.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H10N2.C9H7N.HI/c1-11-7-3-5-8-4-2-6-10-9(8)11;1-2-6-9-8(4-1)5-3-7-10-9;/h2-6H,7H2,1H3;1-7H;1H |
| InChIKey | ZYZGXZIQFKWZCY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide?
The IUPAC name of 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide (CID 160852732) is 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide.
What is the SMILES notation for 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide?
The canonical SMILES for 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide is CN1CC=Cc2cccnc21.I.c1ccc2ncccc2c1.
What is the InChIKey of 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide?
The InChIKey is ZYZGXZIQFKWZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2.C9H7N.HI/c1-11-7-3-5-8-4-2-6-10-9(8)11;1-2-6-9-8(4-1)5-3-7-10-9;/h2-6H,7H2,1H3;1-7H;1H.
What are the key properties of 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide?
1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide has a molecular weight of 403.27 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-1,8-naphthyridine;quinoline;hydroiodide is sourced from PubChem (CID 160852732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).