C19H16N4O — CID 162008137
7-amino-4-(2-anilinopyrimidin-4-yl)-2,3-dihydroinden-1-one (PubChem CID 162008137) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 7-amino-4-(2-anilinopyrimidin-4-yl)-2,3-dihydroinden-1-one.
| Compound Name | 7-amino-4-(2-anilinopyrimidin-4-yl)-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 162008137 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 7-amino-4-(2-anilinopyrimidin-4-yl)-2,3-dihydroinden-1-one |
| SMILES | Nc1ccc(-c2ccnc(Nc3ccccc3)n2)c2c1C(=O)CC2 |
| InChI | InChI=1S/C19H16N4O/c20-15-8-6-13(14-7-9-17(24)18(14)15)16-10-11-21-19(23-16)22-12-4-2-1-3-5-12/h1-6,8,10-11H,7,9,20H2,(H,21,22,23) |
| InChIKey | YTCOWBICDOWDRL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|