C14H16F14N2O5S2 — CID 162464921
bis(trifluoromethylsulfonyl)azanide;1-methyl-1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]-2,3-dihydropyrrol-1-ium (PubChem CID 162464921) has the molecular formula C14H16F14N2O5S2 and a molecular weight of 622.40 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-methyl-1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]-2,3-dihydropyrrol-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-methyl-1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]-2,3-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 162464921 |
| Molecular Formula | C14H16F14N2O5S2 |
| Molecular Weight | 622.40 g/mol |
| Exact Mass | 622.03 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-methyl-1-[2-(2,2,3,3,4,4,5,5-octafluoropentoxy)ethyl]-2,3-dihydropyrrol-1-ium |
| SMILES | C[N+]1(CCOCC(F)(F)C(F)(F)C(F)(F)C(F)F)C=CCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H16F8NO.C2F6NO4S2/c1-21(4-2-3-5-21)6-7-22-8-10(15,16)12(19,20)11(17,18)9(13)14;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h2,4,9H,3,5-8H2,1H3;/q+1;-1 |
| InChIKey | TZPFLLPKLRURCN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|