C18H16O2 — CID 163063060
6-(3-methyl-6-phenylhexa-1,3,5-trienyl)pyran-2-one (PubChem CID 163063060) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(3-methyl-6-phenylhexa-1,3,5-trienyl)pyran-2-one.
| Compound Name | 6-(3-methyl-6-phenylhexa-1,3,5-trienyl)pyran-2-one |
|---|---|
| PubChem CID | 163063060 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-(3-methyl-6-phenylhexa-1,3,5-trienyl)pyran-2-one |
| SMILES | CC(C=Cc1cccc(=O)o1)=CC=Cc1ccccc1 |
| InChI | InChI=1S/C18H16O2/c1-15(7-5-10-16-8-3-2-4-9-16)13-14-17-11-6-12-18(19)20-17/h2-14H,1H3 |
| InChIKey | JVWQBHWCFLLGBX-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|