C12H16N6O7 — CID 163191007
N-[6-amino-2,4-dioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-7-ylidene]formamide (PubChem CID 163191007) has the molecular formula C12H16N6O7 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-[6-amino-2,4-dioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-7-ylidene]formamide.
| Compound Name | N-[6-amino-2,4-dioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-7-ylidene]formamide |
|---|---|
| PubChem CID | 163191007 |
| Molecular Formula | C12H16N6O7 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-[6-amino-2,4-dioxo-8-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-1H-pteridin-7-ylidene]formamide |
| SMILES | Nc1nc2c(=O)[nH]c(=O)[nH]c2n(C[C@H](O)[C@H](O)[C@H](O)CO)/c1=N/C=O |
| InChI | InChI=1S/C12H16N6O7/c13-8-10(14-3-20)18(1-4(21)7(23)5(22)2-19)9-6(15-8)11(24)17-12(25)16-9/h3-5,7,19,21-23H,1-2H2,(H2,13,15)(H2,16,17,24,25)/b14-10+/t4-,5+,7-/m0/s1 |
| InChIKey | FXZNMYYZFXEFJF-LUYTYUCQSA-N |
| XLogP | -4.87 |
| TPSA | 219.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | -4.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|