C24H19Cl2F3O — CID 163826174
1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4-trifluoropent-1-enyl]naphthalen-1-yl]ethenol (PubChem CID 163826174) has the molecular formula C24H19Cl2F3O and a molecular weight of 451.32 g/mol. Its IUPAC name is 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4-trifluoropent-1-enyl]naphthalen-1-yl]ethenol.
| Compound Name | 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4-trifluoropent-1-enyl]naphthalen-1-yl]ethenol |
|---|---|
| PubChem CID | 163826174 |
| Molecular Formula | C24H19Cl2F3O |
| Molecular Weight | 451.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 1-[4-[(Z)-3-(3,4-dichloro-5-methylphenyl)-1,4,4-trifluoropent-1-enyl]naphthalen-1-yl]ethenol |
| SMILES | C=C(O)c1ccc(/C(F)=C/C(c2cc(C)c(Cl)c(Cl)c2)C(C)(F)F)c2ccccc12 |
| InChI | InChI=1S/C24H19Cl2F3O/c1-13-10-15(11-21(25)23(13)26)20(24(3,28)29)12-22(27)19-9-8-16(14(2)30)17-6-4-5-7-18(17)19/h4-12,20,30H,2H2,1,3H3/b22-12- |
| InChIKey | NZRMZUMPSCLAFL-UUYOSTAYSA-N |
| XLogP | 8.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.32 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|