C14H11N3O3 — CID 164736966
(3R)-3-(2H-pyrrolo[3,2-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione (PubChem CID 164736966) has the molecular formula C14H11N3O3 and a molecular weight of 269.26 g/mol. Its IUPAC name is (3R)-3-(2H-pyrrolo[3,2-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione.
| Compound Name | (3R)-3-(2H-pyrrolo[3,2-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 164736966 |
| Molecular Formula | C14H11N3O3 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (3R)-3-(2H-pyrrolo[3,2-e][1,2]benzoxazol-1-yl)piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](c2[nH]oc3ccc4nccc4c23)C(=O)N1 |
| InChI | InChI=1S/C14H11N3O3/c18-11-4-1-8(14(19)16-11)13-12-7-5-6-15-9(7)2-3-10(12)20-17-13/h2-3,5-6,8,17H,1,4H2,(H,16,18,19)/t8-/m1/s1 |
| InChIKey | OBIZGSSNYVVTJN-MRVPVSSYSA-N |
| XLogP | 1.83 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|