C18H27N3O10 — CID 166868211
2-[[6-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]-1,1-dihydroxyhexan-2-yl]carbamoylamino]pentanedioic acid (PubChem CID 166868211) has the molecular formula C18H27N3O10 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2-[[6-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]-1,1-dihydroxyhexan-2-yl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[6-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]-1,1-dihydroxyhexan-2-yl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 166868211 |
| Molecular Formula | C18H27N3O10 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 2-[[6-[(2-ethoxy-3,4-dioxocyclobuten-1-yl)amino]-1,1-dihydroxyhexan-2-yl]carbamoylamino]pentanedioic acid |
| SMILES | CCOc1c(NCCCCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(O)O)c(=O)c1=O |
| InChI | InChI=1S/C18H27N3O10/c1-2-31-15-12(13(24)14(15)25)19-8-4-3-5-9(16(26)27)20-18(30)21-10(17(28)29)6-7-11(22)23/h9-10,16,19,26-27H,2-8H2,1H3,(H,22,23)(H,28,29)(H2,20,21,30) |
| InChIKey | IAQRXZLYPSWRRU-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 211.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|