C10H4F4O5 — CID 167031762
2,2,3,3-tetrafluoro-4-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-4-oxobutanoic acid (PubChem CID 167031762) has the molecular formula C10H4F4O5 and a molecular weight of 280.13 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-4-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-4-oxobutanoic acid.
| Compound Name | 2,2,3,3-tetrafluoro-4-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 167031762 |
| Molecular Formula | C10H4F4O5 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | 2,2,3,3-tetrafluoro-4-(7-oxabicyclo[2.2.1]hepta-1,3,5-trien-2-yloxy)-4-oxobutanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(=O)Oc1cc2ccc1o2 |
| InChI | InChI=1S/C10H4F4O5/c11-9(12,7(15)16)10(13,14)8(17)19-6-3-4-1-2-5(6)18-4/h1-3H,(H,15,16) |
| InChIKey | NPURKUCKQZZEIJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|