C13H20N2S2 — CID 167138366
(2E,4E)-4-[[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]disulfanyl]hepta-2,4,6-trien-3-amine (PubChem CID 167138366) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is (2E,4E)-4-[[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]disulfanyl]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-4-[[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]disulfanyl]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 167138366 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (2E,4E)-4-[[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]disulfanyl]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C(SSC(/C=C\C)=C(/C)N)\C(N)=C/C |
| InChI | InChI=1S/C13H20N2S2/c1-5-8-12(10(4)14)16-17-13(9-6-2)11(15)7-3/h5-9H,2,14-15H2,1,3-4H3/b8-5-,11-7+,12-10-,13-9+ |
| InChIKey | DLBGCPRSAQFHKS-KZBCSGDYSA-N |
| XLogP | 4.07 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|