C21H17FN2O6 — CID 168556791
3-[[7-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione (PubChem CID 168556791) has the molecular formula C21H17FN2O6 and a molecular weight of 412.37 g/mol. Its IUPAC name is 3-[[7-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione.
| Compound Name | 3-[[7-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 168556791 |
| Molecular Formula | C21H17FN2O6 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-[[7-(4-fluorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]amino]-1-(2-hydroxyethyl)pyrrole-2,5-dione |
| SMILES | O=C(c1ccc(F)cc1)c1cc2c(cc1NC1=CC(=O)N(CCO)C1=O)OCCO2 |
| InChI | InChI=1S/C21H17FN2O6/c22-13-3-1-12(2-4-13)20(27)14-9-17-18(30-8-7-29-17)10-15(14)23-16-11-19(26)24(5-6-25)21(16)28/h1-4,9-11,23,25H,5-8H2 |
| InChIKey | KSLLVDAJGMUQMV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|