C35H31FN2O4S — CID 169135559
N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide (PubChem CID 169135559) has the molecular formula C35H31FN2O4S and a molecular weight of 594.71 g/mol. Its IUPAC name is N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 169135559 |
| Molecular Formula | C35H31FN2O4S |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | N-[3-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(6-hydroxy-5,6,7,8-tetrahydronaphthalen-2-yl)thieno[3,2-c]pyridin-6-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(-c2nc(-c3ccc4c(c3)CCC(O)C4)c3ccsc3c2-c2ccc(F)cc2OCCOC)c1 |
| InChI | InChI=1S/C35H31FN2O4S/c1-3-31(40)37-26-6-4-5-23(18-26)34-32(28-12-10-25(36)20-30(28)42-15-14-41-2)35-29(13-16-43-35)33(38-34)24-8-7-22-19-27(39)11-9-21(22)17-24/h3-8,10,12-13,16-18,20,27,39H,1,9,11,14-15,19H2,2H3,(H,37,40) |
| InChIKey | NXUGRUXCOKULNT-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|