C11H17NO6 — CID 169195806
2-[3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)propylamino]-2-oxoacetic acid (PubChem CID 169195806) has the molecular formula C11H17NO6 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2-[3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)propylamino]-2-oxoacetic acid.
| Compound Name | 2-[3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)propylamino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 169195806 |
| Molecular Formula | C11H17NO6 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[3-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxy)propylamino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)NCCCOC1COC2CCOC21 |
| InChI | InChI=1S/C11H17NO6/c13-10(11(14)15)12-3-1-4-16-8-6-18-7-2-5-17-9(7)8/h7-9H,1-6H2,(H,12,13)(H,14,15) |
| InChIKey | GKBMPTAAYWWWBA-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|