C21H32O2 — CID 169440921
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)phenol (PubChem CID 169440921) has the molecular formula C21H32O2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)phenol.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)phenol |
|---|---|
| PubChem CID | 169440921 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-5-(2,2,3,3,4,4,5,5,5-nonadeuteriopentyl)phenol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Cc1cc(O)cc(OC/C=C(\C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C21H32O2/c1-5-6-7-11-19-14-20(22)16-21(15-19)23-13-12-18(4)10-8-9-17(2)3/h9,12,14-16,22H,5-8,10-11,13H2,1-4H3/b18-12+/i1D3,5D2,6D2,7D2 |
| InChIKey | UHNGDHVOGKMKHT-ZXEODSHZSA-N |
| XLogP | 6.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|