C19H19N — CID 170151835
5,10-dimethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azecine (PubChem CID 170151835) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 5,10-dimethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azecine.
| Compound Name | 5,10-dimethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azecine |
|---|---|
| PubChem CID | 170151835 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 5,10-dimethylidene-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]azecine |
| SMILES | C=C/C=C\C(=C/C=C)c1ccc(=C)ccccc(=C)n1 |
| InChI | InChI=1S/C19H19N/c1-5-7-13-18(10-6-2)19-15-14-16(3)11-8-9-12-17(4)20-19/h5-15H,1-4H2/b11-8-,12-9+,13-7-,15-14+,18-10+,20-19+ |
| InChIKey | LFRKWFRAICBDGF-YHELKRNJSA-N |
| XLogP | 3.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|