C17H25BN2O5S — CID 170805057
4-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dimethylpyrazole-5-carboxylic acid (PubChem CID 170805057) has the molecular formula C17H25BN2O5S and a molecular weight of 380.28 g/mol. Its IUPAC name is 4-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dimethylpyrazole-5-carboxylic acid.
| Compound Name | 4-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dimethylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170805057 |
| Molecular Formula | C17H25BN2O5S |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 4-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-dimethylpyrazole-5-carboxylic acid |
| SMILES | CC(=O)SCC(=Cc1c(C)nn(C)c1C(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BN2O5S/c1-10-13(14(15(22)23)20(7)19-10)8-12(9-26-11(2)21)18-24-16(3,4)17(5,6)25-18/h8H,9H2,1-7H3,(H,22,23) |
| InChIKey | KMYRLYRBTZGUKL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|