C15H19F4NO4 — CID 171558771
2-methyloxane-3,4-diol;prop-1-yne;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite (PubChem CID 171558771) has the molecular formula C15H19F4NO4 and a molecular weight of 353.31 g/mol. Its IUPAC name is 2-methyloxane-3,4-diol;prop-1-yne;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite.
| Compound Name | 2-methyloxane-3,4-diol;prop-1-yne;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
|---|---|
| PubChem CID | 171558771 |
| Molecular Formula | C15H19F4NO4 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-methyloxane-3,4-diol;prop-1-yne;[6-(trifluoromethyl)-2-pyridinyl] hypofluorite |
| SMILES | C#CC.CC1OCCC(O)C1O.FOc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H3F4NO.C6H12O3.C3H4/c7-6(8,9)4-2-1-3-5(11-4)12-10;1-4-6(8)5(7)2-3-9-4;1-3-2/h1-3H;4-8H,2-3H2,1H3;1H,2H3 |
| InChIKey | JWJPKXDLHRNNKC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|