C31H43N3O6 — CID 171575933
4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxy-N,N-dimethylaniline (PubChem CID 171575933) has the molecular formula C31H43N3O6 and a molecular weight of 553.70 g/mol. Its IUPAC name is 4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxy-N,N-dimethylaniline.
| Compound Name | 4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 171575933 |
| Molecular Formula | C31H43N3O6 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | 4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxy-N,N-dimethylaniline |
| SMILES | COc1cc(N(C)C)cc(OC)c1C(c1c(OC)cc(N(C)C)cc1OC)c1c(OC)cc(N(C)C)cc1OC |
| InChI | InChI=1S/C31H43N3O6/c1-32(2)19-13-22(35-7)28(23(14-19)36-8)31(29-24(37-9)15-20(33(3)4)16-25(29)38-10)30-26(39-11)17-21(34(5)6)18-27(30)40-12/h13-18,31H,1-12H3 |
| InChIKey | WSFHVDTXGSCJBK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|