C25H46BrNO2 — CID 173439808
[2-[2-(diethylamino)ethyl]-5,9,13-trimethyltetradeca-4,8,12-trienyl] acetate;hydrobromide (PubChem CID 173439808) has the molecular formula C25H46BrNO2 and a molecular weight of 472.55 g/mol. Its IUPAC name is [2-[2-(diethylamino)ethyl]-5,9,13-trimethyltetradeca-4,8,12-trienyl] acetate;hydrobromide.
| Compound Name | [2-[2-(diethylamino)ethyl]-5,9,13-trimethyltetradeca-4,8,12-trienyl] acetate;hydrobromide |
|---|---|
| PubChem CID | 173439808 |
| Molecular Formula | C25H46BrNO2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | [2-[2-(diethylamino)ethyl]-5,9,13-trimethyltetradeca-4,8,12-trienyl] acetate;hydrobromide |
| SMILES | Br.CCN(CC)CCC(CC=C(C)CCC=C(C)CCC=C(C)C)COC(C)=O |
| InChI | InChI=1S/C25H45NO2.BrH/c1-8-26(9-2)19-18-25(20-28-24(7)27)17-16-23(6)15-11-14-22(5)13-10-12-21(3)4;/h12,14,16,25H,8-11,13,15,17-20H2,1-7H3;1H |
| InChIKey | VJHHQRUZIFHHIG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|