About (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol
(4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol (PubChem CID 174283855) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol.
Molecular Properties
| Compound Name | (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol |
| PubChem CID | 174283855 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol |
| SMILES | O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.OCC1CCCN1 |
| InChI | InChI=1S/C13H9NO3.C5H11NO/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;7-4-5-2-1-3-6-5/h1-9H;5-7H,1-4H2 |
| InChIKey | UUDJWOBVLYDUER-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol?
The IUPAC name of (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol (CID 174283855) is (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol.
What is the SMILES notation for (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol?
The canonical SMILES for (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol is O=C(c1ccccc1)c1ccc([N+](=O)[O-])cc1.OCC1CCCN1.
What is the InChIKey of (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol?
The InChIKey is UUDJWOBVLYDUER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO3.C5H11NO/c15-13(10-4-2-1-3-5-10)11-6-8-12(9-7-11)14(16)17;7-4-5-2-1-3-6-5/h1-9H;5-7H,1-4H2.
What are the key properties of (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol?
(4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol has a molecular weight of 328.37 g/mol, XLogP of 2.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)-phenylmethanone;pyrrolidin-2-ylmethanol is sourced from PubChem (CID 174283855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).