About bromo(triethyl)silane;tetraphenylboranuide
bromo(triethyl)silane;tetraphenylboranuide (PubChem CID 174492282) has the molecular formula C30H35BBrSi-
and a molecular weight of 514.41 g/mol. Its IUPAC name is bromo(triethyl)silane;tetraphenylboranuide.
Molecular Properties
| Compound Name | bromo(triethyl)silane;tetraphenylboranuide |
| PubChem CID | 174492282 |
| Molecular Formula | C30H35BBrSi- |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | bromo(triethyl)silane;tetraphenylboranuide |
| SMILES | CC[Si](Br)(CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H20B.C6H15BrSi/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-8(7,5-2)6-3/h1-20H;4-6H2,1-3H3/q-1; |
| InChIKey | WXSGKSGTYFALSD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromo(triethyl)silane;tetraphenylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(triethyl)silane;tetraphenylboranuide?
The IUPAC name of bromo(triethyl)silane;tetraphenylboranuide (CID 174492282) is bromo(triethyl)silane;tetraphenylboranuide.
What is the SMILES notation for bromo(triethyl)silane;tetraphenylboranuide?
The canonical SMILES for bromo(triethyl)silane;tetraphenylboranuide is CC[Si](Br)(CC)CC.c1ccc([B-](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bromo(triethyl)silane;tetraphenylboranuide?
The InChIKey is WXSGKSGTYFALSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20B.C6H15BrSi/c1-5-13-21(14-6-1)25(22-15-7-2-8-16-22,23-17-9-3-10-18-23)24-19-11-4-12-20-24;1-4-8(7,5-2)6-3/h1-20H;4-6H2,1-3H3/q-1;.
What are the key properties of bromo(triethyl)silane;tetraphenylboranuide?
bromo(triethyl)silane;tetraphenylboranuide has a molecular weight of 514.41 g/mol, XLogP of 6.45, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(triethyl)silane;tetraphenylboranuide is sourced from PubChem (CID 174492282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).